C15H19Cl2N — CID 62309590
1-(2,4-dichlorophenyl)-N-propylhex-4-yn-2-amine (PubChem CID 62309590) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-propylhex-4-yn-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-propylhex-4-yn-2-amine |
|---|---|
| PubChem CID | 62309590 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-propylhex-4-yn-2-amine |
| SMILES | CC#CCC(Cc1ccc(Cl)cc1Cl)NCCC |
| InChI | InChI=1S/C15H19Cl2N/c1-3-5-6-14(18-9-4-2)10-12-7-8-13(16)11-15(12)17/h7-8,11,14,18H,4,6,9-10H2,1-2H3 |
| InChIKey | MGYOJGPWERVPOI-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|