C16H21F2N — CID 104805793
1-(2,4-difluorophenyl)-N-propylhept-5-yn-2-amine (PubChem CID 104805793) has the molecular formula C16H21F2N and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-propylhept-5-yn-2-amine.
| Compound Name | 1-(2,4-difluorophenyl)-N-propylhept-5-yn-2-amine |
|---|---|
| PubChem CID | 104805793 |
| Molecular Formula | C16H21F2N |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-propylhept-5-yn-2-amine |
| SMILES | CC#CCCC(Cc1ccc(F)cc1F)NCCC |
| InChI | InChI=1S/C16H21F2N/c1-3-5-6-7-15(19-10-4-2)11-13-8-9-14(17)12-16(13)18/h8-9,12,15,19H,4,6-7,10-11H2,1-2H3 |
| InChIKey | BEVSBWVIXMKIAR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|