C15H20F5N — CID 115516838
1-(2,4-difluorophenyl)-6,6,6-trifluoro-N-propylhexan-2-amine (PubChem CID 115516838) has the molecular formula C15H20F5N and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-6,6,6-trifluoro-N-propylhexan-2-amine.
| Compound Name | 1-(2,4-difluorophenyl)-6,6,6-trifluoro-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 115516838 |
| Molecular Formula | C15H20F5N |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-6,6,6-trifluoro-N-propylhexan-2-amine |
| SMILES | CCCNC(CCCC(F)(F)F)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F5N/c1-2-8-21-13(4-3-7-15(18,19)20)9-11-5-6-12(16)10-14(11)17/h5-6,10,13,21H,2-4,7-9H2,1H3 |
| InChIKey | AFISWRVNVULQTG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |