C16H24F3N — CID 115516541
6,6,6-trifluoro-1-(3-methylphenyl)-N-propylhexan-2-amine (PubChem CID 115516541) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(3-methylphenyl)-N-propylhexan-2-amine.
| Compound Name | 6,6,6-trifluoro-1-(3-methylphenyl)-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 115516541 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 6,6,6-trifluoro-1-(3-methylphenyl)-N-propylhexan-2-amine |
| SMILES | CCCNC(CCCC(F)(F)F)Cc1cccc(C)c1 |
| InChI | InChI=1S/C16H24F3N/c1-3-10-20-15(8-5-9-16(17,18)19)12-14-7-4-6-13(2)11-14/h4,6-7,11,15,20H,3,5,8-10,12H2,1-2H3 |
| InChIKey | LNBOPUPEZUBJMU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |