C15H21N — CID 62235336
1-(3-methylphenyl)-N-propylpent-4-yn-2-amine (PubChem CID 62235336) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-propylpent-4-yn-2-amine.
| Compound Name | 1-(3-methylphenyl)-N-propylpent-4-yn-2-amine |
|---|---|
| PubChem CID | 62235336 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 1-(3-methylphenyl)-N-propylpent-4-yn-2-amine |
| SMILES | C#CCC(Cc1cccc(C)c1)NCCC |
| InChI | InChI=1S/C15H21N/c1-4-7-15(16-10-5-2)12-14-9-6-8-13(3)11-14/h1,6,8-9,11,15-16H,5,7,10,12H2,2-3H3 |
| InChIKey | NWDZOEKLAFEFMI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|