C15H21F4N — CID 115516510
6,6,6-trifluoro-1-(2-fluorophenyl)-N-propylhexan-2-amine (PubChem CID 115516510) has the molecular formula C15H21F4N and a molecular weight of 291.33 g/mol. Its IUPAC name is 6,6,6-trifluoro-1-(2-fluorophenyl)-N-propylhexan-2-amine.
| Compound Name | 6,6,6-trifluoro-1-(2-fluorophenyl)-N-propylhexan-2-amine |
|---|---|
| PubChem CID | 115516510 |
| Molecular Formula | C15H21F4N |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 6,6,6-trifluoro-1-(2-fluorophenyl)-N-propylhexan-2-amine |
| SMILES | CCCNC(CCCC(F)(F)F)Cc1ccccc1F |
| InChI | InChI=1S/C15H21F4N/c1-2-10-20-13(7-5-9-15(17,18)19)11-12-6-3-4-8-14(12)16/h3-4,6,8,13,20H,2,5,7,9-11H2,1H3 |
| InChIKey | UEEGNTCBWLGIAF-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |