C14H19F4N — CID 115516684
5,5,5-trifluoro-1-(2-fluorophenyl)-N-propylpentan-1-amine (PubChem CID 115516684) has the molecular formula C14H19F4N and a molecular weight of 277.30 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(2-fluorophenyl)-N-propylpentan-1-amine.
| Compound Name | 5,5,5-trifluoro-1-(2-fluorophenyl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 115516684 |
| Molecular Formula | C14H19F4N |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 5,5,5-trifluoro-1-(2-fluorophenyl)-N-propylpentan-1-amine |
| SMILES | CCCNC(CCCC(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C14H19F4N/c1-2-10-19-13(8-5-9-14(16,17)18)11-6-3-4-7-12(11)15/h3-4,6-7,13,19H,2,5,8-10H2,1H3 |
| InChIKey | QSYUEJINTBVDDJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |