C18H29F2N — CID 115835811
1-(2,3-difluorophenyl)-N-propylnonan-1-amine (PubChem CID 115835811) has the molecular formula C18H29F2N and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(2,3-difluorophenyl)-N-propylnonan-1-amine.
| Compound Name | 1-(2,3-difluorophenyl)-N-propylnonan-1-amine |
|---|---|
| PubChem CID | 115835811 |
| Molecular Formula | C18H29F2N |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 1-(2,3-difluorophenyl)-N-propylnonan-1-amine |
| SMILES | CCCCCCCCC(NCCC)c1cccc(F)c1F |
| InChI | InChI=1S/C18H29F2N/c1-3-5-6-7-8-9-13-17(21-14-4-2)15-11-10-12-16(19)18(15)20/h10-12,17,21H,3-9,13-14H2,1-2H3 |
| InChIKey | RTEVTBLLDGWHNO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|