C14H18Br2F3N — CID 105024009
1-(2,5-dibromophenyl)-5,5,5-trifluoro-N-propylpentan-1-amine (PubChem CID 105024009) has the molecular formula C14H18Br2F3N and a molecular weight of 417.11 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-5,5,5-trifluoro-N-propylpentan-1-amine.
| Compound Name | 1-(2,5-dibromophenyl)-5,5,5-trifluoro-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 105024009 |
| Molecular Formula | C14H18Br2F3N |
| Molecular Weight | 417.11 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | 1-(2,5-dibromophenyl)-5,5,5-trifluoro-N-propylpentan-1-amine |
| SMILES | CCCNC(CCCC(F)(F)F)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C14H18Br2F3N/c1-2-8-20-13(4-3-7-14(17,18)19)11-9-10(15)5-6-12(11)16/h5-6,9,13,20H,2-4,7-8H2,1H3 |
| InChIKey | BTFCPMUKCTZRJV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.11 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |