C14H18F5N — CID 105024336
1-(2,6-difluorophenyl)-N-ethyl-6,6,6-trifluorohexan-2-amine (PubChem CID 105024336) has the molecular formula C14H18F5N and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-ethyl-6,6,6-trifluorohexan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-N-ethyl-6,6,6-trifluorohexan-2-amine |
|---|---|
| PubChem CID | 105024336 |
| Molecular Formula | C14H18F5N |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-ethyl-6,6,6-trifluorohexan-2-amine |
| SMILES | CCNC(CCCC(F)(F)F)Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H18F5N/c1-2-20-10(5-4-8-14(17,18)19)9-11-12(15)6-3-7-13(11)16/h3,6-7,10,20H,2,4-5,8-9H2,1H3 |
| InChIKey | PTZSFMJYIQXCID-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |