C13H16F5N — CID 105024000
1-(2,6-difluorophenyl)-6,6,6-trifluoro-N-methylhexan-2-amine (PubChem CID 105024000) has the molecular formula C13H16F5N and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-6,6,6-trifluoro-N-methylhexan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-6,6,6-trifluoro-N-methylhexan-2-amine |
|---|---|
| PubChem CID | 105024000 |
| Molecular Formula | C13H16F5N |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(2,6-difluorophenyl)-6,6,6-trifluoro-N-methylhexan-2-amine |
| SMILES | CNC(CCCC(F)(F)F)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H16F5N/c1-19-9(4-3-7-13(16,17)18)8-10-11(14)5-2-6-12(10)15/h2,5-6,9,19H,3-4,7-8H2,1H3 |
| InChIKey | XYZDASGQXJGXIM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |