C16H19F2NS — CID 115861194
1-(2,6-difluorophenyl)-N-ethyl-4-thiophen-2-ylbutan-2-amine (PubChem CID 115861194) has the molecular formula C16H19F2NS and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-N-ethyl-4-thiophen-2-ylbutan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-N-ethyl-4-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 115861194 |
| Molecular Formula | C16H19F2NS |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-(2,6-difluorophenyl)-N-ethyl-4-thiophen-2-ylbutan-2-amine |
| SMILES | CCNC(CCc1cccs1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C16H19F2NS/c1-2-19-12(8-9-13-5-4-10-20-13)11-14-15(17)6-3-7-16(14)18/h3-7,10,12,19H,2,8-9,11H2,1H3 |
| InChIKey | YJWWWFCWUFHQEH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |