C12H18F3NS — CID 79952596
N-ethyl-6,6,6-trifluoro-1-thiophen-2-ylhexan-3-amine (PubChem CID 79952596) has the molecular formula C12H18F3NS and a molecular weight of 265.34 g/mol. Its IUPAC name is N-ethyl-6,6,6-trifluoro-1-thiophen-2-ylhexan-3-amine.
| Compound Name | N-ethyl-6,6,6-trifluoro-1-thiophen-2-ylhexan-3-amine |
|---|---|
| PubChem CID | 79952596 |
| Molecular Formula | C12H18F3NS |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-ethyl-6,6,6-trifluoro-1-thiophen-2-ylhexan-3-amine |
| SMILES | CCNC(CCc1cccs1)CCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NS/c1-2-16-10(7-8-12(13,14)15)5-6-11-4-3-9-17-11/h3-4,9-10,16H,2,5-8H2,1H3 |
| InChIKey | OCMVNLJZIICVHO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |