C16H21NS2 — CID 65143428
N-ethyl-1-phenylsulfanyl-4-thiophen-2-ylbutan-2-amine (PubChem CID 65143428) has the molecular formula C16H21NS2 and a molecular weight of 291.49 g/mol. Its IUPAC name is N-ethyl-1-phenylsulfanyl-4-thiophen-2-ylbutan-2-amine.
| Compound Name | N-ethyl-1-phenylsulfanyl-4-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 65143428 |
| Molecular Formula | C16H21NS2 |
| Molecular Weight | 291.49 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-ethyl-1-phenylsulfanyl-4-thiophen-2-ylbutan-2-amine |
| SMILES | CCNC(CCc1cccs1)CSc1ccccc1 |
| InChI | InChI=1S/C16H21NS2/c1-2-17-14(10-11-16-9-6-12-18-16)13-19-15-7-4-3-5-8-15/h3-9,12,14,17H,2,10-11,13H2,1H3 |
| InChIKey | OPDBEIGKOSHPHG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |