C12H21NS2 — CID 65128461
N-ethyl-1-ethylsulfanyl-4-thiophen-2-ylbutan-2-amine (PubChem CID 65128461) has the molecular formula C12H21NS2 and a molecular weight of 243.44 g/mol. Its IUPAC name is N-ethyl-1-ethylsulfanyl-4-thiophen-2-ylbutan-2-amine.
| Compound Name | N-ethyl-1-ethylsulfanyl-4-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 65128461 |
| Molecular Formula | C12H21NS2 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N-ethyl-1-ethylsulfanyl-4-thiophen-2-ylbutan-2-amine |
| SMILES | CCNC(CCc1cccs1)CSCC |
| InChI | InChI=1S/C12H21NS2/c1-3-13-11(10-14-4-2)7-8-12-6-5-9-15-12/h5-6,9,11,13H,3-4,7-8,10H2,1-2H3 |
| InChIKey | CLYDXBFZEOEVSX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |