C13H23NOS — CID 63775940
N-ethyl-1-propoxy-4-thiophen-2-ylbutan-2-amine (PubChem CID 63775940) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is N-ethyl-1-propoxy-4-thiophen-2-ylbutan-2-amine.
| Compound Name | N-ethyl-1-propoxy-4-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 63775940 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | N-ethyl-1-propoxy-4-thiophen-2-ylbutan-2-amine |
| SMILES | CCCOCC(CCc1cccs1)NCC |
| InChI | InChI=1S/C13H23NOS/c1-3-9-15-11-12(14-4-2)7-8-13-6-5-10-16-13/h5-6,10,12,14H,3-4,7-9,11H2,1-2H3 |
| InChIKey | GESCKMIBDLEGPR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|