C13H23NS — CID 61065868
N-ethyl-5-methyl-1-thiophen-2-ylhexan-2-amine (PubChem CID 61065868) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is N-ethyl-5-methyl-1-thiophen-2-ylhexan-2-amine.
| Compound Name | N-ethyl-5-methyl-1-thiophen-2-ylhexan-2-amine |
|---|---|
| PubChem CID | 61065868 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-ethyl-5-methyl-1-thiophen-2-ylhexan-2-amine |
| SMILES | CCNC(CCC(C)C)Cc1cccs1 |
| InChI | InChI=1S/C13H23NS/c1-4-14-12(8-7-11(2)3)10-13-6-5-9-15-13/h5-6,9,11-12,14H,4,7-8,10H2,1-3H3 |
| InChIKey | QIPPVKZHRRYFHR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |