C12H15NS2 — CID 43755169
N-ethyl-1,2-dithiophen-2-ylethanamine (PubChem CID 43755169) has the molecular formula C12H15NS2 and a molecular weight of 237.39 g/mol. Its IUPAC name is N-ethyl-1,2-dithiophen-2-ylethanamine.
| Compound Name | N-ethyl-1,2-dithiophen-2-ylethanamine |
|---|---|
| PubChem CID | 43755169 |
| Molecular Formula | C12H15NS2 |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-ethyl-1,2-dithiophen-2-ylethanamine |
| SMILES | CCNC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C12H15NS2/c1-2-13-11(12-6-4-8-15-12)9-10-5-3-7-14-10/h3-8,11,13H,2,9H2,1H3 |
| InChIKey | BMKFDJLOSLDWBV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |