C15H21NOS2 — CID 115719311
1-(1,2-dithiophen-2-ylethylamino)pentan-2-ol (PubChem CID 115719311) has the molecular formula C15H21NOS2 and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-(1,2-dithiophen-2-ylethylamino)pentan-2-ol.
| Compound Name | 1-(1,2-dithiophen-2-ylethylamino)pentan-2-ol |
|---|---|
| PubChem CID | 115719311 |
| Molecular Formula | C15H21NOS2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-(1,2-dithiophen-2-ylethylamino)pentan-2-ol |
| SMILES | CCCC(O)CNC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H21NOS2/c1-2-5-12(17)11-16-14(15-7-4-9-19-15)10-13-6-3-8-18-13/h3-4,6-9,12,14,16-17H,2,5,10-11H2,1H3 |
| InChIKey | CCKFKTQDYGSVBV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |