C17H19NS3 — CID 43783115
N-(1,2-dithiophen-2-ylethyl)-1-thiophen-2-ylpropan-2-amine (PubChem CID 43783115) has the molecular formula C17H19NS3 and a molecular weight of 333.55 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)-1-thiophen-2-ylpropan-2-amine.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 43783115 |
| Molecular Formula | C17H19NS3 |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)-1-thiophen-2-ylpropan-2-amine |
| SMILES | CC(Cc1cccs1)NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H19NS3/c1-13(11-14-5-2-8-19-14)18-16(17-7-4-10-21-17)12-15-6-3-9-20-15/h2-10,13,16,18H,11-12H2,1H3 |
| InChIKey | COXQKUITSXAFJC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |