C13H17NOS2 — CID 114986973
(2R)-2-(1,2-dithiophen-2-ylethylamino)propan-1-ol (PubChem CID 114986973) has the molecular formula C13H17NOS2 and a molecular weight of 267.42 g/mol. Its IUPAC name is (2R)-2-(1,2-dithiophen-2-ylethylamino)propan-1-ol.
| Compound Name | (2R)-2-(1,2-dithiophen-2-ylethylamino)propan-1-ol |
|---|---|
| PubChem CID | 114986973 |
| Molecular Formula | C13H17NOS2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2R)-2-(1,2-dithiophen-2-ylethylamino)propan-1-ol |
| SMILES | C[C@H](CO)NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C13H17NOS2/c1-10(9-15)14-12(13-5-3-7-17-13)8-11-4-2-6-16-11/h2-7,10,12,14-15H,8-9H2,1H3/t10-,12?/m1/s1 |
| InChIKey | QIYRODWMZSSBDQ-RWANSRKNSA-N |
| XLogP | 3.06 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |