C16H21NS2 — CID 63989311
1-cyclopropyl-N-(1,2-dithiophen-2-ylethyl)propan-2-amine (PubChem CID 63989311) has the molecular formula C16H21NS2 and a molecular weight of 291.49 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1,2-dithiophen-2-ylethyl)propan-2-amine.
| Compound Name | 1-cyclopropyl-N-(1,2-dithiophen-2-ylethyl)propan-2-amine |
|---|---|
| PubChem CID | 63989311 |
| Molecular Formula | C16H21NS2 |
| Molecular Weight | 291.49 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-cyclopropyl-N-(1,2-dithiophen-2-ylethyl)propan-2-amine |
| SMILES | CC(CC1CC1)NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H21NS2/c1-12(10-13-6-7-13)17-15(16-5-3-9-19-16)11-14-4-2-8-18-14/h2-5,8-9,12-13,15,17H,6-7,10-11H2,1H3 |
| InChIKey | NTQUCYSSHLYFAN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |