C15H19NOS2 — CID 63294884
1-cyclopropyl-2-(1,2-dithiophen-2-ylethylamino)ethanol (PubChem CID 63294884) has the molecular formula C15H19NOS2 and a molecular weight of 293.46 g/mol. Its IUPAC name is 1-cyclopropyl-2-(1,2-dithiophen-2-ylethylamino)ethanol.
| Compound Name | 1-cyclopropyl-2-(1,2-dithiophen-2-ylethylamino)ethanol |
|---|---|
| PubChem CID | 63294884 |
| Molecular Formula | C15H19NOS2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-cyclopropyl-2-(1,2-dithiophen-2-ylethylamino)ethanol |
| SMILES | OC(CNC(Cc1cccs1)c1cccs1)C1CC1 |
| InChI | InChI=1S/C15H19NOS2/c17-14(11-5-6-11)10-16-13(15-4-2-8-19-15)9-12-3-1-7-18-12/h1-4,7-8,11,13-14,16-17H,5-6,9-10H2 |
| InChIKey | KLJVISXYNBPQOC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |