C16H21NOS2 — CID 65105159
1-[(1,2-dithiophen-2-ylethylamino)methyl]cyclopentan-1-ol (PubChem CID 65105159) has the molecular formula C16H21NOS2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 1-[(1,2-dithiophen-2-ylethylamino)methyl]cyclopentan-1-ol.
| Compound Name | 1-[(1,2-dithiophen-2-ylethylamino)methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65105159 |
| Molecular Formula | C16H21NOS2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[(1,2-dithiophen-2-ylethylamino)methyl]cyclopentan-1-ol |
| SMILES | OC1(CNC(Cc2cccs2)c2cccs2)CCCC1 |
| InChI | InChI=1S/C16H21NOS2/c18-16(7-1-2-8-16)12-17-14(15-6-4-10-20-15)11-13-5-3-9-19-13/h3-6,9-10,14,17-18H,1-2,7-8,11-12H2 |
| InChIKey | HNADTXUUYCPZEG-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |