C10H15NOS — CID 115621566
1-[(thiophen-2-ylmethylamino)methyl]cyclobutan-1-ol (PubChem CID 115621566) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is 1-[(thiophen-2-ylmethylamino)methyl]cyclobutan-1-ol.
| Compound Name | 1-[(thiophen-2-ylmethylamino)methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 115621566 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 1-[(thiophen-2-ylmethylamino)methyl]cyclobutan-1-ol |
| SMILES | OC1(CNCc2cccs2)CCC1 |
| InChI | InChI=1S/C10H15NOS/c12-10(4-2-5-10)8-11-7-9-3-1-6-13-9/h1,3,6,11-12H,2,4-5,7-8H2 |
| InChIKey | CDLBWJZFFVKOOM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |