C14H19NO2S2 — CID 43771514
2-[2-(1,2-dithiophen-2-ylethylamino)ethoxy]ethanol (PubChem CID 43771514) has the molecular formula C14H19NO2S2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 2-[2-(1,2-dithiophen-2-ylethylamino)ethoxy]ethanol.
| Compound Name | 2-[2-(1,2-dithiophen-2-ylethylamino)ethoxy]ethanol |
|---|---|
| PubChem CID | 43771514 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[2-(1,2-dithiophen-2-ylethylamino)ethoxy]ethanol |
| SMILES | OCCOCCNC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C14H19NO2S2/c16-6-8-17-7-5-15-13(14-4-2-10-19-14)11-12-3-1-9-18-12/h1-4,9-10,13,15-16H,5-8,11H2 |
| InChIKey | QSDGKLHTPHHOSZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|