C13H23NO2S — CID 111439573
2-[2-[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]ethoxy]ethanol (PubChem CID 111439573) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-[2-[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]ethoxy]ethanol.
| Compound Name | 2-[2-[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 111439573 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[2-[(2,2-dimethyl-1-thiophen-2-ylpropyl)amino]ethoxy]ethanol |
| SMILES | CC(C)(C)C(NCCOCCO)c1cccs1 |
| InChI | InChI=1S/C13H23NO2S/c1-13(2,3)12(11-5-4-10-17-11)14-6-8-16-9-7-15/h4-5,10,12,14-15H,6-9H2,1-3H3 |
| InChIKey | GRYNGKAGKPGEDH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|