C16H20N2OS2 — CID 79378036
N-cyclopropyl-3-(1,2-dithiophen-2-ylethylamino)propanamide (PubChem CID 79378036) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-cyclopropyl-3-(1,2-dithiophen-2-ylethylamino)propanamide.
| Compound Name | N-cyclopropyl-3-(1,2-dithiophen-2-ylethylamino)propanamide |
|---|---|
| PubChem CID | 79378036 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-cyclopropyl-3-(1,2-dithiophen-2-ylethylamino)propanamide |
| SMILES | O=C(CCNC(Cc1cccs1)c1cccs1)NC1CC1 |
| InChI | InChI=1S/C16H20N2OS2/c19-16(18-12-5-6-12)7-8-17-14(15-4-2-10-21-15)11-13-3-1-9-20-13/h1-4,9-10,12,14,17H,5-8,11H2,(H,18,19) |
| InChIKey | RSULSBLFKQJSTI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |