C16H23NOS2 — CID 103786463
3-(1,2-dithiophen-2-ylethylamino)-4-methylpentan-1-ol (PubChem CID 103786463) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 3-(1,2-dithiophen-2-ylethylamino)-4-methylpentan-1-ol.
| Compound Name | 3-(1,2-dithiophen-2-ylethylamino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 103786463 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 3-(1,2-dithiophen-2-ylethylamino)-4-methylpentan-1-ol |
| SMILES | CC(C)C(CCO)NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H23NOS2/c1-12(2)14(7-8-18)17-15(16-6-4-10-20-16)11-13-5-3-9-19-13/h3-6,9-10,12,14-15,17-18H,7-8,11H2,1-2H3 |
| InChIKey | JYUVGFKVJUVCFK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |