C15H21NOS2 — CID 79254175
(2S)-2-(1,2-dithiophen-2-ylethylamino)-3-methylbutan-1-ol (PubChem CID 79254175) has the molecular formula C15H21NOS2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (2S)-2-(1,2-dithiophen-2-ylethylamino)-3-methylbutan-1-ol.
| Compound Name | (2S)-2-(1,2-dithiophen-2-ylethylamino)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 79254175 |
| Molecular Formula | C15H21NOS2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2S)-2-(1,2-dithiophen-2-ylethylamino)-3-methylbutan-1-ol |
| SMILES | CC(C)[C@@H](CO)NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H21NOS2/c1-11(2)14(10-17)16-13(15-6-4-8-19-15)9-12-5-3-7-18-12/h3-8,11,13-14,16-17H,9-10H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | FPGUYMIMHZVGNS-ARLHGKGLSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |