C17H17NS2 — CID 43765840
N-(1,2-dithiophen-2-ylethyl)-4-methylaniline (PubChem CID 43765840) has the molecular formula C17H17NS2 and a molecular weight of 299.46 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)-4-methylaniline.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)-4-methylaniline |
|---|---|
| PubChem CID | 43765840 |
| Molecular Formula | C17H17NS2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)-4-methylaniline |
| SMILES | Cc1ccc(NC(Cc2cccs2)c2cccs2)cc1 |
| InChI | InChI=1S/C17H17NS2/c1-13-6-8-14(9-7-13)18-16(17-5-3-11-20-17)12-15-4-2-10-19-15/h2-11,16,18H,12H2,1H3 |
| InChIKey | XJBRCLQDLDAYSA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |