C12H14N2S — CID 63292001
N-(1-thiophen-2-ylpropan-2-yl)pyridin-4-amine (PubChem CID 63292001) has the molecular formula C12H14N2S and a molecular weight of 218.33 g/mol. Its IUPAC name is N-(1-thiophen-2-ylpropan-2-yl)pyridin-4-amine.
| Compound Name | N-(1-thiophen-2-ylpropan-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 63292001 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | N-(1-thiophen-2-ylpropan-2-yl)pyridin-4-amine |
| SMILES | CC(Cc1cccs1)Nc1ccncc1 |
| InChI | InChI=1S/C12H14N2S/c1-10(9-12-3-2-8-15-12)14-11-4-6-13-7-5-11/h2-8,10H,9H2,1H3,(H,13,14) |
| InChIKey | JCIOYBGOPXKGJL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |