C10H15NS — CID 82262604
N-(1-thiophen-2-ylpropan-2-yl)cyclopropanamine (PubChem CID 82262604) has the molecular formula C10H15NS and a molecular weight of 181.30 g/mol. Its IUPAC name is N-(1-thiophen-2-ylpropan-2-yl)cyclopropanamine.
| Compound Name | N-(1-thiophen-2-ylpropan-2-yl)cyclopropanamine |
|---|---|
| PubChem CID | 82262604 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(1-thiophen-2-ylpropan-2-yl)cyclopropanamine |
| SMILES | CC(Cc1cccs1)NC1CC1 |
| InChI | InChI=1S/C10H15NS/c1-8(11-9-4-5-9)7-10-3-2-6-12-10/h2-3,6,8-9,11H,4-5,7H2,1H3 |
| InChIKey | YWJZNZGWTFHJPI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |