C11H17NS — CID 103439266
N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclopropanamine (PubChem CID 103439266) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclopropanamine.
| Compound Name | N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclopropanamine |
|---|---|
| PubChem CID | 103439266 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-[1-(5-methylthiophen-2-yl)propan-2-yl]cyclopropanamine |
| SMILES | Cc1ccc(CC(C)NC2CC2)s1 |
| InChI | InChI=1S/C11H17NS/c1-8(12-10-4-5-10)7-11-6-3-9(2)13-11/h3,6,8,10,12H,4-5,7H2,1-2H3 |
| InChIKey | NPEXSYVBNXNHGE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |