C11H14N2O2S — CID 63291448
3-(1-thiophen-2-ylpropan-2-ylamino)pyrrolidine-2,5-dione (PubChem CID 63291448) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-(1-thiophen-2-ylpropan-2-ylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(1-thiophen-2-ylpropan-2-ylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 63291448 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-(1-thiophen-2-ylpropan-2-ylamino)pyrrolidine-2,5-dione |
| SMILES | CC(Cc1cccs1)NC1CC(=O)NC1=O |
| InChI | InChI=1S/C11H14N2O2S/c1-7(5-8-3-2-4-16-8)12-9-6-10(14)13-11(9)15/h2-4,7,9,12H,5-6H2,1H3,(H,13,14,15) |
| InChIKey | AKQDHJZELIFHBG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|