C14H23NS2 — CID 79948426
4,4-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)thian-3-amine (PubChem CID 79948426) has the molecular formula C14H23NS2 and a molecular weight of 269.48 g/mol. Its IUPAC name is 4,4-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)thian-3-amine.
| Compound Name | 4,4-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)thian-3-amine |
|---|---|
| PubChem CID | 79948426 |
| Molecular Formula | C14H23NS2 |
| Molecular Weight | 269.48 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 4,4-dimethyl-N-(1-thiophen-2-ylpropan-2-yl)thian-3-amine |
| SMILES | CC(Cc1cccs1)NC1CSCCC1(C)C |
| InChI | InChI=1S/C14H23NS2/c1-11(9-12-5-4-7-17-12)15-13-10-16-8-6-14(13,2)3/h4-5,7,11,13,15H,6,8-10H2,1-3H3 |
| InChIKey | AZJIQTSXBOKSTB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |