C10H17NS — CID 43692824
N-propyl-1-thiophen-2-ylpropan-2-amine (PubChem CID 43692824) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is N-propyl-1-thiophen-2-ylpropan-2-amine.
| Compound Name | N-propyl-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 43692824 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | N-propyl-1-thiophen-2-ylpropan-2-amine |
| SMILES | CCCNC(C)Cc1cccs1 |
| InChI | InChI=1S/C10H17NS/c1-3-6-11-9(2)8-10-5-4-7-12-10/h4-5,7,9,11H,3,6,8H2,1-2H3 |
| InChIKey | OEMGSTNHBGXOJT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |