C11H19NS2 — CID 104668568
N-(2-ethylsulfanylethyl)-1-thiophen-2-ylpropan-2-amine (PubChem CID 104668568) has the molecular formula C11H19NS2 and a molecular weight of 229.41 g/mol. Its IUPAC name is N-(2-ethylsulfanylethyl)-1-thiophen-2-ylpropan-2-amine.
| Compound Name | N-(2-ethylsulfanylethyl)-1-thiophen-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 104668568 |
| Molecular Formula | C11H19NS2 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-(2-ethylsulfanylethyl)-1-thiophen-2-ylpropan-2-amine |
| SMILES | CCSCCNC(C)Cc1cccs1 |
| InChI | InChI=1S/C11H19NS2/c1-3-13-8-6-12-10(2)9-11-5-4-7-14-11/h4-5,7,10,12H,3,6,8-9H2,1-2H3 |
| InChIKey | MTEJPNVGJUHPNV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|