C10H15NO2S — CID 63291768
3-(1-thiophen-2-ylpropan-2-ylamino)propanoic acid (PubChem CID 63291768) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3-(1-thiophen-2-ylpropan-2-ylamino)propanoic acid.
| Compound Name | 3-(1-thiophen-2-ylpropan-2-ylamino)propanoic acid |
|---|---|
| PubChem CID | 63291768 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3-(1-thiophen-2-ylpropan-2-ylamino)propanoic acid |
| SMILES | CC(Cc1cccs1)NCCC(=O)O |
| InChI | InChI=1S/C10H15NO2S/c1-8(11-5-4-10(12)13)7-9-3-2-6-14-9/h2-3,6,8,11H,4-5,7H2,1H3,(H,12,13) |
| InChIKey | LTFUUWNWGIUCBR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |