C11H16NO6PS — CID 70067523
3-[[2-(phosphonomethyl)-3-thiophen-2-ylpropanoyl]amino]propanoic acid (PubChem CID 70067523) has the molecular formula C11H16NO6PS and a molecular weight of 321.29 g/mol. Its IUPAC name is 3-[[2-(phosphonomethyl)-3-thiophen-2-ylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-(phosphonomethyl)-3-thiophen-2-ylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70067523 |
| Molecular Formula | C11H16NO6PS |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-[[2-(phosphonomethyl)-3-thiophen-2-ylpropanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(Cc1cccs1)CP(=O)(O)O |
| InChI | InChI=1S/C11H16NO6PS/c13-10(14)3-4-12-11(15)8(7-19(16,17)18)6-9-2-1-5-20-9/h1-2,5,8H,3-4,6-7H2,(H,12,15)(H,13,14)(H2,16,17,18) |
| InChIKey | FYTQPNSHQLSFTC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|