C15H13ClN2S2 — CID 43782525
2-chloro-N-(1,2-dithiophen-2-ylethyl)pyridin-3-amine (PubChem CID 43782525) has the molecular formula C15H13ClN2S2 and a molecular weight of 320.87 g/mol. Its IUPAC name is 2-chloro-N-(1,2-dithiophen-2-ylethyl)pyridin-3-amine.
| Compound Name | 2-chloro-N-(1,2-dithiophen-2-ylethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 43782525 |
| Molecular Formula | C15H13ClN2S2 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-chloro-N-(1,2-dithiophen-2-ylethyl)pyridin-3-amine |
| SMILES | Clc1ncccc1NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C15H13ClN2S2/c16-15-12(5-1-7-17-15)18-13(14-6-3-9-20-14)10-11-4-2-8-19-11/h1-9,13,18H,10H2 |
| InChIKey | GOJMHTUCVZOFRW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|