C16H14BrNS2 — CID 43762685
2-bromo-N-(1,2-dithiophen-2-ylethyl)aniline (PubChem CID 43762685) has the molecular formula C16H14BrNS2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 2-bromo-N-(1,2-dithiophen-2-ylethyl)aniline.
| Compound Name | 2-bromo-N-(1,2-dithiophen-2-ylethyl)aniline |
|---|---|
| PubChem CID | 43762685 |
| Molecular Formula | C16H14BrNS2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 2-bromo-N-(1,2-dithiophen-2-ylethyl)aniline |
| SMILES | Brc1ccccc1NC(Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C16H14BrNS2/c17-13-6-1-2-7-14(13)18-15(16-8-4-10-20-16)11-12-5-3-9-19-12/h1-10,15,18H,11H2 |
| InChIKey | ZNFBKLBNCYHBAQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |