C13H13N3S2 — CID 43776937
N-(1,2-dithiophen-2-ylethyl)-1H-pyrazol-4-amine (PubChem CID 43776937) has the molecular formula C13H13N3S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)-1H-pyrazol-4-amine.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43776937 |
| Molecular Formula | C13H13N3S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)-1H-pyrazol-4-amine |
| SMILES | c1csc(CC(Nc2cn[nH]c2)c2cccs2)c1 |
| InChI | InChI=1S/C13H13N3S2/c1-3-11(17-5-1)7-12(13-4-2-6-18-13)16-10-8-14-15-9-10/h1-6,8-9,12,16H,7H2,(H,14,15) |
| InChIKey | YSZVUAMFOOPLTP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |