C12H11N3S3 — CID 107648576
N-(1,2-dithiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648576) has the molecular formula C12H11N3S3 and a molecular weight of 293.44 g/mol. Its IUPAC name is N-(1,2-dithiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(1,2-dithiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648576 |
| Molecular Formula | C12H11N3S3 |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | N-(1,2-dithiophen-2-ylethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1csc(CC(Nc2nncs2)c2cccs2)c1 |
| InChI | InChI=1S/C12H11N3S3/c1-3-9(16-5-1)7-10(11-4-2-6-17-11)14-12-15-13-8-18-12/h1-6,8,10H,7H2,(H,14,15) |
| InChIKey | IUAWSPJASRFTQU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |