C15H21N3 — CID 43776931
N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazol-4-amine (PubChem CID 43776931) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazol-4-amine.
| Compound Name | N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43776931 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-(3,3-dimethyl-1-phenylbutyl)-1H-pyrazol-4-amine |
| SMILES | CC(C)(C)CC(Nc1cn[nH]c1)c1ccccc1 |
| InChI | InChI=1S/C15H21N3/c1-15(2,3)9-14(12-7-5-4-6-8-12)18-13-10-16-17-11-13/h4-8,10-11,14,18H,9H2,1-3H3,(H,16,17) |
| InChIKey | SULRXOBDFVEVKI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |