C17H16BrNS2 — CID 60781438
N-[(4-bromophenyl)methyl]-1,2-dithiophen-2-ylethanamine (PubChem CID 60781438) has the molecular formula C17H16BrNS2 and a molecular weight of 378.36 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-1,2-dithiophen-2-ylethanamine.
| Compound Name | N-[(4-bromophenyl)methyl]-1,2-dithiophen-2-ylethanamine |
|---|---|
| PubChem CID | 60781438 |
| Molecular Formula | C17H16BrNS2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-1,2-dithiophen-2-ylethanamine |
| SMILES | Brc1ccc(CNC(Cc2cccs2)c2cccs2)cc1 |
| InChI | InChI=1S/C17H16BrNS2/c18-14-7-5-13(6-8-14)12-19-16(17-4-2-10-21-17)11-15-3-1-9-20-15/h1-10,16,19H,11-12H2 |
| InChIKey | UWPSMJGMMXRGSA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |