C14H18ClNOS2 — CID 79254049
2-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]-3-methylbutan-1-ol (PubChem CID 79254049) has the molecular formula C14H18ClNOS2 and a molecular weight of 315.89 g/mol. Its IUPAC name is 2-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]-3-methylbutan-1-ol.
| Compound Name | 2-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 79254049 |
| Molecular Formula | C14H18ClNOS2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]amino]-3-methylbutan-1-ol |
| SMILES | CC(C)C(CO)NC(c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H18ClNOS2/c1-9(2)10(8-17)16-14(11-4-3-7-18-11)12-5-6-13(15)19-12/h3-7,9-10,14,16-17H,8H2,1-2H3 |
| InChIKey | BDNRALHJTAMMER-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |