C12H14ClNOS2 — CID 43756293
N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-methoxyethanamine (PubChem CID 43756293) has the molecular formula C12H14ClNOS2 and a molecular weight of 287.84 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-methoxyethanamine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 43756293 |
| Molecular Formula | C12H14ClNOS2 |
| Molecular Weight | 287.84 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-methoxyethanamine |
| SMILES | COCCNC(c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H14ClNOS2/c1-15-7-6-14-12(9-3-2-8-16-9)10-4-5-11(13)17-10/h2-5,8,12,14H,6-7H2,1H3 |
| InChIKey | OKXLHSVXIYUWPE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|