C17H24ClNS2 — CID 43767499
N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-ethylhexan-1-amine (PubChem CID 43767499) has the molecular formula C17H24ClNS2 and a molecular weight of 341.97 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-ethylhexan-1-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-ethylhexan-1-amine |
|---|---|
| PubChem CID | 43767499 |
| Molecular Formula | C17H24ClNS2 |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)-thiophen-2-ylmethyl]-2-ethylhexan-1-amine |
| SMILES | CCCCC(CC)CNC(c1cccs1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H24ClNS2/c1-3-5-7-13(4-2)12-19-17(14-8-6-11-20-14)15-9-10-16(18)21-15/h6,8-11,13,17,19H,3-5,7,12H2,1-2H3 |
| InChIKey | LLHQREWPDXJVPJ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |