C16H15ClN2S2 — CID 62323529
1-(5-chlorothiophen-2-yl)-N-[(6-methyl-2-pyridinyl)methyl]-1-thiophen-2-ylmethanamine (PubChem CID 62323529) has the molecular formula C16H15ClN2S2 and a molecular weight of 334.90 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-[(6-methyl-2-pyridinyl)methyl]-1-thiophen-2-ylmethanamine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-[(6-methyl-2-pyridinyl)methyl]-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 62323529 |
| Molecular Formula | C16H15ClN2S2 |
| Molecular Weight | 334.90 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-[(6-methyl-2-pyridinyl)methyl]-1-thiophen-2-ylmethanamine |
| SMILES | Cc1cccc(CNC(c2cccs2)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C16H15ClN2S2/c1-11-4-2-5-12(19-11)10-18-16(13-6-3-9-20-13)14-7-8-15(17)21-14/h2-9,16,18H,10H2,1H3 |
| InChIKey | GNVMUAHULLEXJN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |